C22H23N7O4 — CID 3838203
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 3838203) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3838203 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitro-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccn2)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H23N7O4/c30-29(31)20-21(24-12-17-3-1-2-6-23-17)25-14-26-22(20)28-9-7-27(8-10-28)13-16-4-5-18-19(11-16)33-15-32-18/h1-6,11,14H,7-10,12-13,15H2,(H,24,25,26) |
| InChIKey | NWNCRJATBUVOKE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|