C28H27N7O5 — CID 3569299
2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide (PubChem CID 3569299) has the molecular formula C28H27N7O5 and a molecular weight of 541.57 g/mol. Its IUPAC name is 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 3569299 |
| Molecular Formula | C28H27N7O5 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]-N-naphthalen-2-ylacetamide |
| SMILES | O=C(CNc1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-])Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H27N7O5/c36-25(32-22-7-6-20-3-1-2-4-21(20)14-22)15-29-27-26(35(37)38)28(31-17-30-27)34-11-9-33(10-12-34)16-19-5-8-23-24(13-19)40-18-39-23/h1-8,13-14,17H,9-12,15-16,18H2,(H,32,36)(H,29,30,31) |
| InChIKey | HFSUNHZPCNPWLK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|