C22H22N8O5 — CID 22536718
N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 22536718) has the molecular formula C22H22N8O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 22536718 |
| Molecular Formula | C22H22N8O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C22H22N8O5/c31-22(16-3-1-2-6-23-16)27-26-20-19(30(32)33)21(25-13-24-20)29-9-7-28(8-10-29)12-15-4-5-17-18(11-15)35-14-34-17/h1-6,11,13H,7-10,12,14H2,(H,27,31)(H,24,25,26) |
| InChIKey | KCAFECSBPAVYAB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 147.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|