C24H25N7O6 — CID 22536125
N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 22536125) has the molecular formula C24H25N7O6 and a molecular weight of 507.51 g/mol. Its IUPAC name is N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 22536125 |
| Molecular Formula | C24H25N7O6 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N'-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25N7O6/c1-35-18-5-3-2-4-17(18)24(32)28-27-22-21(31(33)34)23(26-14-25-22)30-10-8-29(9-11-30)13-16-6-7-19-20(12-16)37-15-36-19/h2-7,12,14H,8-11,13,15H2,1H3,(H,28,32)(H,25,26,27) |
| InChIKey | DRLQCXUUCPALJZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|