C22H22FN7O4 — CID 22536127
N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 22536127) has the molecular formula C22H22FN7O4 and a molecular weight of 467.46 g/mol. Its IUPAC name is N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 22536127 |
| Molecular Formula | C22H22FN7O4 |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22FN7O4/c1-34-18-5-3-2-4-17(18)22(31)27-26-20-19(30(32)33)21(25-14-24-20)29-12-10-28(11-13-29)16-8-6-15(23)7-9-16/h2-9,14H,10-13H2,1H3,(H,27,31)(H,24,25,26) |
| InChIKey | RPUSMYKASGQDQF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|