C23H25N7O4 — CID 23491258
N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide (PubChem CID 23491258) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide.
| Compound Name | N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 23491258 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25N7O4/c1-34-19-10-6-5-9-18(19)23(31)27-26-21-20(30(32)33)22(25-16-24-21)29-13-11-28(12-14-29)15-17-7-3-2-4-8-17/h2-10,16H,11-15H2,1H3,(H,27,31)(H,24,25,26) |
| InChIKey | DLNVOVRFIZSRMK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|