C15H15ClN6O3 — CID 23489238
2-chloro-N'-(5-nitro-6-pyrrolidin-1-ylpyrimidin-4-yl)benzohydrazide (PubChem CID 23489238) has the molecular formula C15H15ClN6O3 and a molecular weight of 362.78 g/mol. Its IUPAC name is 2-chloro-N'-(5-nitro-6-pyrrolidin-1-ylpyrimidin-4-yl)benzohydrazide.
| Compound Name | 2-chloro-N'-(5-nitro-6-pyrrolidin-1-ylpyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 23489238 |
| Molecular Formula | C15H15ClN6O3 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-chloro-N'-(5-nitro-6-pyrrolidin-1-ylpyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCCC2)c1[N+](=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN6O3/c16-11-6-2-1-5-10(11)15(23)20-19-13-12(22(24)25)14(18-9-17-13)21-7-3-4-8-21/h1-2,5-6,9H,3-4,7-8H2,(H,20,23)(H,17,18,19) |
| InChIKey | DMOIYGOSNNEPHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|