C15H16N6O4 — CID 23489598
N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)benzohydrazide (PubChem CID 23489598) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)benzohydrazide.
| Compound Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 23489598 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCOCC2)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H16N6O4/c22-15(11-4-2-1-3-5-11)19-18-13-12(21(23)24)14(17-10-16-13)20-6-8-25-9-7-20/h1-5,10H,6-9H2,(H,19,22)(H,16,17,18) |
| InChIKey | PQTZXRMZKZGUPY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|