C18H13N7O3 — CID 22535069
N'-[6-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535069) has the molecular formula C18H13N7O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is N'-[6-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535069 |
| Molecular Formula | C18H13N7O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N'-[6-(benzimidazol-1-yl)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(-n2cnc3ccccc32)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H13N7O3/c26-18(12-6-2-1-3-7-12)23-22-16-15(25(27)28)17(20-10-19-16)24-11-21-13-8-4-5-9-14(13)24/h1-11H,(H,23,26)(H,19,20,22) |
| InChIKey | DTNKGADSBHZLBS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|