C23H16N8O2 — CID 22529153
6-(benzimidazol-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine (PubChem CID 22529153) has the molecular formula C23H16N8O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 6-(benzimidazol-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine.
| Compound Name | 6-(benzimidazol-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22529153 |
| Molecular Formula | C23H16N8O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 6-(benzimidazol-1-yl)-5-nitro-N-(4-phenyldiazenylphenyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(/N=N/c3ccccc3)cc2)ncnc1-n1cnc2ccccc21 |
| InChI | InChI=1S/C23H16N8O2/c32-31(33)21-22(24-14-25-23(21)30-15-26-19-8-4-5-9-20(19)30)27-16-10-12-18(13-11-16)29-28-17-6-2-1-3-7-17/h1-15H,(H,24,25,27)/b29-28+ |
| InChIKey | WBWDPCAFMFEVCW-ZQHSETAFSA-N |
| XLogP | 5.88 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|