C23H23N7O4 — CID 22529128
methyl 1-[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 22529128) has the molecular formula C23H23N7O4 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 1-[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22529128 |
| Molecular Formula | C23H23N7O4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | methyl 1-[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(Nc3ccc(/N=N/c4ccccc4)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H23N7O4/c1-34-23(31)16-11-13-29(14-12-16)22-20(30(32)33)21(24-15-25-22)26-17-7-9-19(10-8-17)28-27-18-5-3-2-4-6-18/h2-10,15-16H,11-14H2,1H3,(H,24,25,26)/b28-27+ |
| InChIKey | QYPHKCXSRTUEDN-BYYHNAKLSA-N |
| XLogP | 4.93 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|