C19H21N5O6 — CID 23494250
4-[[6-(4-ethoxycarbonylpiperidin-1-yl)-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 23494250) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-[[6-(4-ethoxycarbonylpiperidin-1-yl)-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(4-ethoxycarbonylpiperidin-1-yl)-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 23494250 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 4-[[6-(4-ethoxycarbonylpiperidin-1-yl)-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3ccc(C(=O)O)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H21N5O6/c1-2-30-19(27)13-7-9-23(10-8-13)17-15(24(28)29)16(20-11-21-17)22-14-5-3-12(4-6-14)18(25)26/h3-6,11,13H,2,7-10H2,1H3,(H,25,26)(H,20,21,22) |
| InChIKey | CMQMILZCHRYAKU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 147.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|