C20H22F3N5O4 — CID 58216502
ethyl 1-[6-[3-methyl-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 58216502) has the molecular formula C20H22F3N5O4 and a molecular weight of 453.42 g/mol. Its IUPAC name is ethyl 1-[6-[3-methyl-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[3-methyl-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58216502 |
| Molecular Formula | C20H22F3N5O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | ethyl 1-[6-[3-methyl-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3cc(C)cc(C(F)(F)F)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H22F3N5O4/c1-3-32-19(29)13-4-6-27(7-5-13)18-16(28(30)31)17(24-11-25-18)26-15-9-12(2)8-14(10-15)20(21,22)23/h8-11,13H,3-7H2,1-2H3,(H,24,25,26) |
| InChIKey | AMUMHHGUZMQDCF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|