C18H19Cl2N5O4 — CID 23485455
ethyl 1-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23485455) has the molecular formula C18H19Cl2N5O4 and a molecular weight of 440.29 g/mol. Its IUPAC name is ethyl 1-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23485455 |
| Molecular Formula | C18H19Cl2N5O4 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | ethyl 1-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3ccc(Cl)c(Cl)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H19Cl2N5O4/c1-2-29-18(26)11-5-7-24(8-6-11)17-15(25(27)28)16(21-10-22-17)23-12-3-4-13(19)14(20)9-12/h3-4,9-11H,2,5-8H2,1H3,(H,21,22,23) |
| InChIKey | KDDQNQNFZKVZJS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|