C17H19ClN6O4 — CID 23494253
ethyl 1-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23494253) has the molecular formula C17H19ClN6O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is ethyl 1-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23494253 |
| Molecular Formula | C17H19ClN6O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | ethyl 1-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3cccnc3Cl)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H19ClN6O4/c1-2-28-17(25)11-5-8-23(9-6-11)16-13(24(26)27)15(20-10-21-16)22-12-4-3-7-19-14(12)18/h3-4,7,10-11H,2,5-6,8-9H2,1H3,(H,20,21,22) |
| InChIKey | IIYFNTDOAFBOIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|