C19H23N5O4 — CID 23494308
ethyl 1-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494308) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 1-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494308 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | ethyl 1-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3ccccc3C)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H23N5O4/c1-3-28-19(25)14-8-6-10-23(11-14)18-16(24(26)27)17(20-12-21-18)22-15-9-5-4-7-13(15)2/h4-5,7,9,12,14H,3,6,8,10-11H2,1-2H3,(H,20,21,22) |
| InChIKey | ZGFHZLWBOIGRSK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|