C16H25N5O4 — CID 23494405
ethyl 1-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494405) has the molecular formula C16H25N5O4 and a molecular weight of 351.41 g/mol. Its IUPAC name is ethyl 1-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494405 |
| Molecular Formula | C16H25N5O4 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethyl 1-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NC(C)CC)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H25N5O4/c1-4-11(3)19-14-13(21(23)24)15(18-10-17-14)20-8-6-7-12(9-20)16(22)25-5-2/h10-12H,4-9H2,1-3H3,(H,17,18,19) |
| InChIKey | WVTASMUBVJVTAC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|