C20H23N5O6 — CID 23494297
ethyl 1-[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494297) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl 1-[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494297 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 1-[6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3ccc4c(c3)OCCO4)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H23N5O6/c1-2-29-20(26)13-4-3-7-24(11-13)19-17(25(27)28)18(21-12-22-19)23-14-5-6-15-16(10-14)31-9-8-30-15/h5-6,10,12-13H,2-4,7-9,11H2,1H3,(H,21,22,23) |
| InChIKey | IXSVUFRZVHZBMQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|