C18H20N6O6 — CID 23480732
ethyl 4-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 23480732) has the molecular formula C18H20N6O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is ethyl 4-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23480732 |
| Molecular Formula | C18H20N6O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | ethyl 4-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3ccc4c(c3)OCO4)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H20N6O6/c1-2-28-18(25)23-7-5-22(6-8-23)17-15(24(26)27)16(19-10-20-17)21-12-3-4-13-14(9-12)30-11-29-13/h3-4,9-10H,2,5-8,11H2,1H3,(H,19,20,21) |
| InChIKey | ZGQSRRIQKGUBAQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|