C24H26N6O4 — CID 22530594
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 22530594) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22530594 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1cccc(N2CCN(c3ncnc(Nc4ccc5c(c4)OCCO5)c3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C24H26N6O4/c1-16-4-3-5-19(17(16)2)28-8-10-29(11-9-28)24-22(30(31)32)23(25-15-26-24)27-18-6-7-20-21(14-18)34-13-12-33-20/h3-7,14-15H,8-13H2,1-2H3,(H,25,26,27) |
| InChIKey | ZDNFIFDPQZGHEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|