C19H15N5O6 — CID 23480617
4-N-(1,3-benzodioxol-5-yl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23480617) has the molecular formula C19H15N5O6 and a molecular weight of 409.36 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480617 |
| Molecular Formula | C19H15N5O6 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCCO3)ncnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15N5O6/c25-24(26)17-18(22-11-1-3-13-15(7-11)28-6-5-27-13)20-9-21-19(17)23-12-2-4-14-16(8-12)30-10-29-14/h1-4,7-9H,5-6,10H2,(H2,20,21,22,23) |
| InChIKey | JMGCOLFGUNSTBO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|