C18H12F3N5O4 — CID 23480532
6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 23480532) has the molecular formula C18H12F3N5O4 and a molecular weight of 419.32 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23480532 |
| Molecular Formula | C18H12F3N5O4 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-5-nitro-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc3c(c2)OCO3)ncnc1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N5O4/c19-18(20,21)11-3-1-2-4-12(11)25-17-15(26(27)28)16(22-8-23-17)24-10-5-6-13-14(7-10)30-9-29-13/h1-8H,9H2,(H2,22,23,24,25) |
| InChIKey | HXOPTCOZHUSLSX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|