C15H11F3N6O3 — CID 23478879
4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine (PubChem CID 23478879) has the molecular formula C15H11F3N6O3 and a molecular weight of 380.29 g/mol. Its IUPAC name is 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478879 |
| Molecular Formula | C15H11F3N6O3 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitro-6-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,6-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3ccccc3C(F)(F)F)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C15H11F3N6O3/c1-8-6-11(23-27-8)22-14-12(24(25)26)13(19-7-20-14)21-10-5-3-2-4-9(10)15(16,17)18/h2-7H,1H3,(H2,19,20,21,22,23) |
| InChIKey | OSURVIKTGQTBRW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|