C15H13ClN6O4 — CID 23478881
6-N-(5-chloro-2-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23478881) has the molecular formula C15H13ClN6O4 and a molecular weight of 376.76 g/mol. Its IUPAC name is 6-N-(5-chloro-2-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(5-chloro-2-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478881 |
| Molecular Formula | C15H13ClN6O4 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-N-(5-chloro-2-methoxyphenyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(Cl)cc1Nc1ncnc(Nc2cc(C)on2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClN6O4/c1-8-5-12(21-26-8)20-15-13(22(23)24)14(17-7-18-15)19-10-6-9(16)3-4-11(10)25-2/h3-7H,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | BNUSNKILTJMDJY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|