C16H13Cl2N7O5 — CID 23479032
2-(2,4-dichlorophenoxy)-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]acetohydrazide (PubChem CID 23479032) has the molecular formula C16H13Cl2N7O5 and a molecular weight of 454.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 23479032 |
| Molecular Formula | C16H13Cl2N7O5 |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]acetohydrazide |
| SMILES | Cc1cc(Nc2ncnc(NNC(=O)COc3ccc(Cl)cc3Cl)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C16H13Cl2N7O5/c1-8-4-12(24-30-8)21-15-14(25(27)28)16(20-7-19-15)23-22-13(26)6-29-11-3-2-9(17)5-10(11)18/h2-5,7H,6H2,1H3,(H,22,26)(H2,19,20,21,23,24) |
| InChIKey | XRCKTMWLLRFMOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|