C20H18Cl2N6O4 — CID 23479509
2-(2,4-dichlorophenoxy)-N'-[6-(3,5-dimethylanilino)-5-nitropyrimidin-4-yl]acetohydrazide (PubChem CID 23479509) has the molecular formula C20H18Cl2N6O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-[6-(3,5-dimethylanilino)-5-nitropyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-[6-(3,5-dimethylanilino)-5-nitropyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 23479509 |
| Molecular Formula | C20H18Cl2N6O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-[6-(3,5-dimethylanilino)-5-nitropyrimidin-4-yl]acetohydrazide |
| SMILES | Cc1cc(C)cc(Nc2ncnc(NNC(=O)COc3ccc(Cl)cc3Cl)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18Cl2N6O4/c1-11-5-12(2)7-14(6-11)25-19-18(28(30)31)20(24-10-23-19)27-26-17(29)9-32-16-4-3-13(21)8-15(16)22/h3-8,10H,9H2,1-2H3,(H,26,29)(H2,23,24,25,27) |
| InChIKey | PKPJKDUAMGYZJR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|