C14H13Cl2N5O5 — CID 22537163
2-(2,4-dichlorophenoxy)-N'-(6-ethoxy-5-nitropyrimidin-4-yl)acetohydrazide (PubChem CID 22537163) has the molecular formula C14H13Cl2N5O5 and a molecular weight of 402.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-(6-ethoxy-5-nitropyrimidin-4-yl)acetohydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-(6-ethoxy-5-nitropyrimidin-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 22537163 |
| Molecular Formula | C14H13Cl2N5O5 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-(6-ethoxy-5-nitropyrimidin-4-yl)acetohydrazide |
| SMILES | CCOc1ncnc(NNC(=O)COc2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13Cl2N5O5/c1-2-25-14-12(21(23)24)13(17-7-18-14)20-19-11(22)6-26-10-4-3-8(15)5-9(10)16/h3-5,7H,2,6H2,1H3,(H,19,22)(H,17,18,20) |
| InChIKey | LKPCUDIUPQVRTH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|