C14H16Cl2N6O2 — CID 19135292
N'-[5-amino-6-(ethylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19135292) has the molecular formula C14H16Cl2N6O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is N'-[5-amino-6-(ethylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-(ethylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19135292 |
| Molecular Formula | C14H16Cl2N6O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N'-[5-amino-6-(ethylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | CCNc1ncnc(NNC(=O)COc2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C14H16Cl2N6O2/c1-2-18-13-12(17)14(20-7-19-13)22-21-11(23)6-24-10-4-3-8(15)5-9(10)16/h3-5,7H,2,6,17H2,1H3,(H,21,23)(H2,18,19,20,22) |
| InChIKey | ZMYGKJGYBNCLLL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|