C18H14Cl4N6O2 — CID 19146758
N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19146758) has the molecular formula C18H14Cl4N6O2 and a molecular weight of 488.16 g/mol. Its IUPAC name is N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19146758 |
| Molecular Formula | C18H14Cl4N6O2 |
| Molecular Weight | 488.16 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)ncnc1Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H14Cl4N6O2/c19-9-2-4-14(12(22)5-9)30-7-15(29)27-28-18-16(23)17(24-8-25-18)26-13-6-10(20)1-3-11(13)21/h1-6,8H,7,23H2,(H,27,29)(H2,24,25,26,28) |
| InChIKey | FOJKDUQUXFRFQC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|