C16H18Cl2N6O2 — CID 19137364
N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19137364) has the molecular formula C16H18Cl2N6O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19137364 |
| Molecular Formula | C16H18Cl2N6O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)ncnc1N1CCCC1 |
| InChI | InChI=1S/C16H18Cl2N6O2/c17-10-3-4-12(11(18)7-10)26-8-13(25)22-23-15-14(19)16(21-9-20-15)24-5-1-2-6-24/h3-4,7,9H,1-2,5-6,8,19H2,(H,22,25)(H,20,21,23) |
| InChIKey | VFDLGSCBCMUJKY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|