C20H18Cl2N6O4 — CID 19146509
N'-[5-amino-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19146509) has the molecular formula C20H18Cl2N6O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is N'-[5-amino-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19146509 |
| Molecular Formula | C20H18Cl2N6O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N'-[5-amino-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)ncnc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H18Cl2N6O4/c21-11-1-3-14(13(22)7-11)32-9-17(29)27-28-20-18(23)19(24-10-25-20)26-12-2-4-15-16(8-12)31-6-5-30-15/h1-4,7-8,10H,5-6,9,23H2,(H,27,29)(H2,24,25,26,28) |
| InChIKey | QTIBJECDHVCCQV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|