C17H15Cl2N3O4S — CID 17375539
1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea (PubChem CID 17375539) has the molecular formula C17H15Cl2N3O4S and a molecular weight of 428.30 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea.
| Compound Name | 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
|---|---|
| PubChem CID | 17375539 |
| Molecular Formula | C17H15Cl2N3O4S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)thiourea |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15Cl2N3O4S/c18-10-1-3-13(12(19)7-10)26-9-16(23)21-22-17(27)20-11-2-4-14-15(8-11)25-6-5-24-14/h1-4,7-8H,5-6,9H2,(H,21,23)(H2,20,22,27) |
| InChIKey | UEUPEILBAFQCQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|