C17H13Cl3N2O5 — CID 2571071
N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 2571071) has the molecular formula C17H13Cl3N2O5 and a molecular weight of 431.66 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 2571071 |
| Molecular Formula | C17H13Cl3N2O5 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H13Cl3N2O5/c18-10-6-12(20)14(7-11(10)19)27-8-16(23)22-17(24)21-9-1-2-13-15(5-9)26-4-3-25-13/h1-2,5-7H,3-4,8H2,(H2,21,22,23,24) |
| InChIKey | HJFYWZGRGSTQNZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|