C18H19N3O4S — CID 17375546
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[2-(4-methoxyphenyl)acetyl]amino]thiourea (PubChem CID 17375546) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[2-(4-methoxyphenyl)acetyl]amino]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[2-(4-methoxyphenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 17375546 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[2-(4-methoxyphenyl)acetyl]amino]thiourea |
| SMILES | COc1ccc(CC(=O)NNC(=S)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c1-23-14-5-2-12(3-6-14)10-17(22)20-21-18(26)19-13-4-7-15-16(11-13)25-9-8-24-15/h2-7,11H,8-10H2,1H3,(H,20,22)(H2,19,21,26) |
| InChIKey | WGQVBULPGSCDAV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|