C17H18N2O4S — CID 21178788
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,5-dimethoxyphenyl)thiourea (PubChem CID 21178788) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 21178788 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)Nc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-20-12-4-6-14(21-2)13(10-12)19-17(24)18-11-3-5-15-16(9-11)23-8-7-22-15/h3-6,9-10H,7-8H2,1-2H3,(H2,18,19,24) |
| InChIKey | DAPJAYQBFGIKLE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|