C16H16N2O5 — CID 17378931
1-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)urea (PubChem CID 17378931) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 17378931 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H16N2O5/c1-20-11-4-6-13(21-2)12(8-11)18-16(19)17-10-3-5-14-15(7-10)23-9-22-14/h3-8H,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | VJJBKJXKLTWXIO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |