C17H16N2O4 — CID 108907811
1-(1,3-benzodioxol-5-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea (PubChem CID 108907811) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108907811 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea |
| SMILES | COc1ccc(/C=C/NC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-21-14-5-2-12(3-6-14)8-9-18-17(20)19-13-4-7-15-16(10-13)23-11-22-15/h2-10H,11H2,1H3,(H2,18,19,20)/b9-8+ |
| InChIKey | MOWSJIAIOIUXJN-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |