C19H22N2O4 — CID 113213671
1-(1,3-benzodioxol-5-yl)-3-[2-(4-methoxyphenyl)-2-methylpropyl]urea (PubChem CID 113213671) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-(4-methoxyphenyl)-2-methylpropyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(4-methoxyphenyl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 113213671 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(4-methoxyphenyl)-2-methylpropyl]urea |
| SMILES | COc1ccc(C(C)(C)CNC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-19(2,13-4-7-15(23-3)8-5-13)11-20-18(22)21-14-6-9-16-17(10-14)25-12-24-16/h4-10H,11-12H2,1-3H3,(H2,20,21,22) |
| InChIKey | SVAKYPIQWUHICX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |