C19H22N2O5 — CID 90497922
1-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-(4-ethoxyphenyl)urea (PubChem CID 90497922) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 90497922 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NCC(C)(O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-3-24-15-7-5-14(6-8-15)21-18(22)20-11-19(2,23)13-4-9-16-17(10-13)26-12-25-16/h4-10,23H,3,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | IZUBFOTXVJGVDS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |