C19H21NO6 — CID 90497723
N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3,5-dimethoxybenzamide (PubChem CID 90497723) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 90497723 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(C)(O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H21NO6/c1-19(22,13-4-5-16-17(8-13)26-11-25-16)10-20-18(21)12-6-14(23-2)9-15(7-12)24-3/h4-9,22H,10-11H2,1-3H3,(H,20,21) |
| InChIKey | AAHSAIOJRXVYCA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |