C17H16FNO4 — CID 90497678
N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-fluorobenzamide (PubChem CID 90497678) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-fluorobenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 90497678 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-3-fluorobenzamide |
| SMILES | CC(O)(CNC(=O)c1cccc(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16FNO4/c1-17(21,12-5-6-14-15(8-12)23-10-22-14)9-19-16(20)11-3-2-4-13(18)7-11/h2-8,21H,9-10H2,1H3,(H,19,20) |
| InChIKey | PKBGSCMHOSIIGR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |