C15H15NO5 — CID 71781872
N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]furan-2-carboxamide (PubChem CID 71781872) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]furan-2-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71781872 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]furan-2-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccco1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15NO5/c1-15(18,8-16-14(17)12-3-2-6-19-12)10-4-5-11-13(7-10)21-9-20-11/h2-7,18H,8-9H2,1H3,(H,16,17) |
| InChIKey | TXJLVAFFGCIBNE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |