C19H19NO5 — CID 119183117
4-[[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]carbamoyl]benzoic acid (PubChem CID 119183117) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-[[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]carbamoyl]benzoic acid.
| Compound Name | 4-[[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 119183117 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]carbamoyl]benzoic acid |
| SMILES | CC(C)(CNC(=O)c1ccc(C(=O)O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19NO5/c1-19(2,14-7-8-15-16(9-14)25-11-24-15)10-20-17(21)12-3-5-13(6-4-12)18(22)23/h3-9H,10-11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | GHSXVSVMJKCHLN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |