C18H15F4NO3 — CID 71882151
N-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 71882151) has the molecular formula C18H15F4NO3 and a molecular weight of 369.31 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 71882151 |
| Molecular Formula | C18H15F4NO3 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-methylpropyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | CC(C)(CNC(=O)c1cc(F)c(F)c(F)c1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15F4NO3/c1-18(2,9-3-4-12-13(5-9)26-8-25-12)7-23-17(24)10-6-11(19)15(21)16(22)14(10)20/h3-6H,7-8H2,1-2H3,(H,23,24) |
| InChIKey | CBIRSTVWKGGTKM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|