C16H11F4NO3 — CID 112794847
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 112794847) has the molecular formula C16H11F4NO3 and a molecular weight of 341.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 112794847 |
| Molecular Formula | C16H11F4NO3 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCCO2)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H11F4NO3/c17-10-6-9(13(18)15(20)14(10)19)16(22)21-7-8-1-2-11-12(5-8)24-4-3-23-11/h1-2,5-6H,3-4,7H2,(H,21,22) |
| InChIKey | PGVBZPZDNGCAEQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|