C12H13NO4 — CID 115175589
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-oxopropanamide (PubChem CID 115175589) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-oxopropanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 115175589 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-2-oxopropanamide |
| SMILES | CC(=O)C(=O)NCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H13NO4/c1-8(14)12(15)13-7-9-2-3-10-11(6-9)17-5-4-16-10/h2-3,6H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | MTKBPMIWNPICHW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|