C12H14N2O5 — CID 115179287
2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-3-oxopropanoic acid (PubChem CID 115179287) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 115179287 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)-3-oxopropanoic acid |
| SMILES | NC(C(=O)O)C(=O)NCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14N2O5/c13-10(12(16)17)11(15)14-6-7-1-2-8-9(5-7)19-4-3-18-8/h1-2,5,10H,3-4,6,13H2,(H,14,15)(H,16,17) |
| InChIKey | RAPZGURLVZJMSM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|