C18H18N2O6 — CID 27648551
N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3,5-dimethoxybenzamide (PubChem CID 27648551) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 27648551 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H18N2O6/c1-23-13-5-11(6-14(8-13)24-2)18(22)19-9-17(21)20-12-3-4-15-16(7-12)26-10-25-15/h3-8H,9-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | XYHBBSUJXPQUMI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |