C18H16O4 — CID 59296766
(E)-1-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-3-en-2-one (PubChem CID 59296766) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-3-en-2-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 59296766 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-4-(4-methoxyphenyl)but-3-en-2-one |
| SMILES | COc1ccc(/C=C/C(=O)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16O4/c1-20-16-7-3-13(4-8-16)2-6-15(19)10-14-5-9-17-18(11-14)22-12-21-17/h2-9,11H,10,12H2,1H3/b6-2+ |
| InChIKey | FEZIJQALSWTBRT-QHHAFSJGSA-N |
| XLogP | 3.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|