C19H20O6 — CID 46830515
1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethoxyphenyl)propan-2-one (PubChem CID 46830515) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethoxyphenyl)propan-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 46830515 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,4,6-trimethoxyphenyl)propan-2-one |
| SMILES | COc1cc(OC)c(CC(=O)Cc2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C19H20O6/c1-21-14-9-17(22-2)15(18(10-14)23-3)8-13(20)6-12-4-5-16-19(7-12)25-11-24-16/h4-5,7,9-10H,6,8,11H2,1-3H3 |
| InChIKey | AWVIAOSFCBYNOR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |